Preferred Name |
sulfonic acid |
|
Synonyms |
hydridohydroxidodioxidosulfur sulfonic acid sulphonic acid acide sulfonique Sulfonsaeure HSHO3 [SHO2(OH)] |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29214 |
|
charge |
0 |
|
database_cross_reference |
Gmelin:1404640 |
|
formula |
H2O3S |
|
has exact synonym |
hydridohydroxidodioxidosulfur sulfonic acid |
|
has related synonym |
sulphonic acid acide sulfonique Sulfonsaeure HSHO3 [SHO2(OH)] |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:29214 |
|
in_subset | ||
inchi |
InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3) |
|
inchikey |
BDHFUVZGWQCTTF-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is tautomer of | ||
label |
sulfonic acid |
|
mass |
82.08008 |
|
monoisotopicmass |
81.97247 |
|
notation |
CHEBI:29214 |
|
prefLabel |
sulfonic acid |
|
smiles |
[H]S(O)(=O)=O |
|
subClassOf |
Create mapping