Preferred Name |
aldosterone |
|
Synonyms |
aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al Aldosterone ALDOSTERONE 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al (+)-aldosterone |
|
Definitions |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27584 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB04630 Beilstein:3224996 LIPID_MAPS_instance:LMST02030026 CAS:52-39-1 LINCS:LSM-42770 Drug_Central:111 PDBeChem:AS4 Wikipedia:Aldosterone PMID:10438974 KEGG:C01780 HMDB:HMDB0000037 Reaxys:3224996 |
|
definition |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
formula |
C21H28O5 |
|
has exact synonym |
aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al Aldosterone ALDOSTERONE |
|
has parent hydride | ||
has related synonym |
11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al (+)-aldosterone |
|
has role | ||
has_alternative_id |
CHEBI:22306 CHEBI:40919 CHEBI:2563 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:27584 |
|
in_subset | ||
inchi |
InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 |
|
inchikey |
PQSUYGKTWSAVDQ-ZVIOFETBSA-N |
|
label |
aldosterone |
|
mass |
360.44400 |
|
monoisotopicmass |
360.19367 |
|
notation |
CHEBI:27584 |
|
prefLabel |
aldosterone |
|
smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C=O)C(=O)CO |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_25354 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_64600 http://purl.obolibrary.org/obo/CHEBI_47909 http://purl.obolibrary.org/obo/CHEBI_35346 |