Jump to:
loading...| Preferred Name |
octadec-9-enoate |
|
| Synonyms |
C18:1, n-9(1-) Delta(9)-octadecenoate 9-octadecenoate octadec-9-enoate |
|
| Definitions |
An octadecenoate in which the double bond is at C-9. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_132944 |
|
| charge |
-1 |
|
| definition |
An octadecenoate in which the double bond is at C-9. |
|
| formula |
C18H33O2 |
|
| has exact synonym |
octadec-9-enoate |
|
| has related synonym |
C18:1, n-9(1-) Delta(9)-octadecenoate 9-octadecenoate |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:132944 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1 |
|
| inchikey |
ZQPPMHVWECSIRJ-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
octadec-9-enoate |
|
| mass |
281.454 |
|
| monoisotopicmass |
281.24860 |
|
| notation |
CHEBI:132944 |
|
| prefLabel |
octadec-9-enoate |
|
| smiles |
C(=CCCCCCCCC)CCCCCCCC(=O)[O-] |
|
| subClassOf |
Create mapping