Preferred Name |
ornithine |
|
Synonyms |
2,5-diaminopentanoic acid Ornithine ornithine 2,5-Diaminopentanoic acid DL-Ornithine 2,5-Diaminovaleric acid Orn |
|
Definitions |
An alpha-amino acid that is pentanoic acid bearing two amino substituents at positions 2 and 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18257 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1722296 KNApSAcK:C00001384 Gmelin:847696 Reaxys:1722296 PMID:17190852 KEGG:C01602 PMID:22264337 CAS:616-07-9 PMID:15449570 |
|
formula |
C5H12N2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:7784 |
|
has_exact_synonym |
2,5-diaminopentanoic acid Ornithine ornithine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2,5-Diaminopentanoic acid DL-Ornithine 2,5-Diaminovaleric acid Orn |
|
id |
CHEBI:18257 |
|
in_subset | ||
inchi |
InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
|
inchikey |
AHLPHDHHMVZTML-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
label |
ornithine |
|
mass |
132.16106 |
|
monoisotopicmass |
132.08988 |
|
notation |
CHEBI:18257 |
|
prefLabel |
ornithine |
|
smiles |
NCCCC(N)C(O)=O |
|
textual definition |
An alpha-amino acid that is pentanoic acid bearing two amino substituents at positions 2 and 5. |
|
subClassOf |