loading...| Preferred Name |
Triamterene |
|
| Synonyms |
6-phenylpteridine-2,4,7-triamine triamterenum triamterena triamterene |
|
| Definitions |
Pteridine substituted at positions 2, 4 and 7 with amino groups and at position 6 with a phenyl group. A sodium channel blocker, it is used as a diuretic in the treatment of hypertension and oedema. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9671 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:28435224 Wikipedia:Triamterene PMID:27913567 KEGG:D00386 CAS:396-01-0 LINCS:LSM-4060 PMID:26194642 PMID:26385116 PMID:28588673 PMID:28166217 Drug_Central:2728 |
|
| formula |
C12H11N7 |
|
| has role | ||
| has_alternative_id |
CHEBI:93604 |
|
| has_exact_synonym |
6-phenylpteridine-2,4,7-triamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
triamterenum triamterena triamterene |
|
| has_RxCUI |
10763 |
|
| id |
CHEBI:9671 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H11N7/c13-9-7(6-4-2-1-3-5-6)16-8-10(14)18-12(15)19-11(8)17-9/h1-5H,(H6,13,14,15,17,18,19) |
|
| inchikey |
FNYLWPVRPXGIIP-UHFFFAOYSA-N |
|
| label |
triamterene Triamterene |
|
| mass |
253.263 |
|
| monoisotopicmass |
253.10759 |
|
| notation |
CHEBI:9671 |
|
| prefixIRI |
CHEBI:9671 |
|
| prefLabel |
Triamterene |
|
| smiles |
C1=CC=C(C=C1)C2=NC3=C(N=C2N)N=C(N=C3N)N |
|
| textual definition |
Pteridine substituted at positions 2, 4 and 7 with amino groups and at position 6 with a phenyl group. A sodium channel blocker, it is used as a diuretic in the treatment of hypertension and oedema. |
|
| subClassOf |