loading...| Preferred Name |
Tocainide |
|
| Synonyms |
N-(2,6-dimethylphenyl)alaninamide 2-Amino-N-(2,6-dimethylphenyl)propionamid 2-amino-N-(2,6-dimethylphenyl)propanamide Alanyl-2,6-xylidide 2-Amino-2',6'-propionoxylidide tocainida tocainide tocainidum |
|
| Definitions |
A monocarboxylic acid amide in which 2,6-dimethylphenylaniline and isobutyric acid have combined to form the amide bond; used as a local anaesthetic. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9611 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01056 PMID:12543515 LINCS:LSM-1909 Reaxys:2416564 Beilstein:2416564 CAS:41708-72-9 PMID:9989796 Drug_Central:2686 Wikipedia:Tocainide KEGG:C07142 KEGG:D06172 |
|
| formula |
C11H16N2O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38070 |
|
| has_alternative_id |
CHEBI:106722 |
|
| has_exact_synonym |
N-(2,6-dimethylphenyl)alaninamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Amino-N-(2,6-dimethylphenyl)propionamid 2-amino-N-(2,6-dimethylphenyl)propanamide Alanyl-2,6-xylidide 2-Amino-2',6'-propionoxylidide tocainida tocainide tocainidum |
|
| has_RxCUI |
42359 |
|
| id |
CHEBI:9611 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H16N2O/c1-7-5-4-6-8(2)10(7)13-11(14)9(3)12/h4-6,9H,12H2,1-3H3,(H,13,14) |
|
| inchikey |
BUJAGSGYPOAWEI-UHFFFAOYSA-N |
|
| label |
tocainide Tocainide |
|
| mass |
192.25750 |
|
| monoisotopicmass |
192.12626 |
|
| notation |
CHEBI:9611 |
|
| prefixIRI |
CHEBI:9611 |
|
| prefLabel |
Tocainide |
|
| smiles |
CC(N)C(=O)Nc1c(C)cccc1C |
|
| textual definition |
A monocarboxylic acid amide in which 2,6-dimethylphenylaniline and isobutyric acid have combined to form the amide bond; used as a local anaesthetic. |
|
| subClassOf |