Preferred Name |
entacapone |
|
Synonyms |
(2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide Entacapone N,N-diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl) acrylamide (E)-alpha-Cyano-N,N-diethyl-3,4-dihydroxy-5-nitrocinnamamide entacaponum Comtan Comtess entacapona entacapone |
|
Definitions |
A monocarboxylic acid amide that is N,N-diethylprop-2-enamide in which the hydrogen at position 2 is substituted by a cyano group and the hydrogen at the 3E position is substituted by a 3,4-dihydroxy-5-nitrophenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4798 |
|
charge |
0 |
|
database_cross_reference |
CAS:130929-57-6 PMID:15992091 Wikipedia:Entacapone PMID:19578428 PMID:12952501 PMID:11732751 KEGG:C07943 DrugBank:DB00494 PMID:15875340 Reaxys:8158723 PMID:11586115 PMID:11244274 PMID:15698633 PMID:15878587 Patent:WO2005063693 Patent:EP426468 Drug_Central:1018 PMID:19879254 Patent:US6599530 Patent:US5135950 KEGG:D00781 |
|
formula |
C14H15N3O5 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35470 http://purl.obolibrary.org/obo/CHEBI_66956 |
|
has_exact_synonym |
(2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide Entacapone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N,N-diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl) acrylamide (E)-alpha-Cyano-N,N-diethyl-3,4-dihydroxy-5-nitrocinnamamide entacaponum Comtan Comtess entacapona entacapone |
|
has_RxCUI |
60307 |
|
id |
CHEBI:4798 |
|
in_subset | ||
inchi |
InChI=1S/C14H15N3O5/c1-3-16(4-2)14(20)10(8-15)5-9-6-11(17(21)22)13(19)12(18)7-9/h5-7,18-19H,3-4H2,1-2H3/b10-5+ |
|
inchikey |
JRURYQJSLYLRLN-BJMVGYQFSA-N |
|
label |
entacapone |
|
mass |
305.28612 |
|
monoisotopicmass |
305.10117 |
|
notation |
CHEBI:4798 |
|
prefixIRI |
CHEBI:4798 |
|
prefLabel |
entacapone |
|
smiles |
CCN(CC)C(=O)C(\C#N)=C\c1cc(O)c(O)c(c1)[N+]([O-])=O |
|
textual definition |
A monocarboxylic acid amide that is N,N-diethylprop-2-enamide in which the hydrogen at position 2 is substituted by a cyano group and the hydrogen at the 3E position is substituted by a 3,4-dihydroxy-5-nitrophenyl group. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_86421 http://purl.obolibrary.org/obo/CHEBI_33566 |