Preferred Name |
Propofol |
|
Synonyms |
2,6-bis(propan-2-yl)phenol Propofol 2,6-BIS(1-METHYLETHYL)PHENOL 2,6-Diisopropylphenol 2,6-bis(1-methylethyl)phenol Diprivan Disoprivan Disoprofol Rapinovet propofol propofolum |
|
Definitions |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44915 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Propofol LINCS:LSM-3847 CAS:2078-54-8 Beilstein:1866484 DrugBank:DB00818 KEGG:D00549 KEGG:C07523 Drug_Central:2302 PDBeChem:PFL VSDB:1846 |
|
formula |
C12H18O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_50919 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
has_alternative_id |
CHEBI:44914 CHEBI:8495 |
|
has_exact_synonym |
2,6-bis(propan-2-yl)phenol Propofol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2,6-BIS(1-METHYLETHYL)PHENOL 2,6-Diisopropylphenol 2,6-bis(1-methylethyl)phenol Diprivan Disoprivan Disoprofol Rapinovet propofol propofolum |
|
has_RxCUI |
8782 |
|
id |
CHEBI:44915 |
|
in_subset | ||
inchi |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 |
|
inchikey |
OLBCVFGFOZPWHH-UHFFFAOYSA-N |
|
label |
Propofol propofol |
|
mass |
178.27072 |
|
monoisotopicmass |
178.13577 |
|
notation |
CHEBI:44915 |
|
prefixIRI |
CHEBI:44915 |
|
prefLabel |
Propofol |
|
smiles |
CC(C)c1cccc(C(C)C)c1O |
|
textual definition |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
subClassOf |