Preferred Name |
desmopressin |
|
Synonyms |
1-{[(4R,7S,10S,13S,16S)-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-D-arginylglycinamide desmopressin desmopressine 1-deamino-8-D-arginine vasopressin 1-desamino-8-D-arginine vasopressin 1-(3-mercaptopropionic acid)-8-D-arginine-vasopressin desmopressinum desmopresina DDAVP |
|
Definitions |
A synthetic analogue of vasopressin in which 3-mercaptopropionic acid replaces the cysteine residue at position 1 and D-arginine replaces the residue at position 8. An antidiuretic, it increases urine concentration and decreases urine production, and is used (usually as the trihydrate of the acetic acid salt) to prevent and control excessive thirst, urination, and dehydration caused by injury, surgery, and certain medical conditions. It is also used in the diagnosis and treatment of cranial diabetes insipidus and in tests of renal function. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4450 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:817 Beilstein:4651966 DrugBank:DB00035 KEGG:C06944 CAS:16679-58-6 KEGG:D00291 |
|
formula |
C46H64N14O12S2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_33295 |
|
has_exact_synonym |
1-{[(4R,7S,10S,13S,16S)-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-D-arginylglycinamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
desmopressin desmopressine 1-deamino-8-D-arginine vasopressin 1-desamino-8-D-arginine vasopressin 1-(3-mercaptopropionic acid)-8-D-arginine-vasopressin desmopressinum desmopresina DDAVP |
|
has_RxCUI |
3251 |
|
id |
CHEBI:4450 |
|
in_subset | ||
inchi |
InChI=1S/C46H64N14O12S2/c47-35(62)15-14-29-40(67)58-32(22-36(48)63)43(70)59-33(45(72)60-18-5-9-34(60)44(71)56-28(8-4-17-52-46(50)51)39(66)53-23-37(49)64)24-74-73-19-16-38(65)54-30(21-26-10-12-27(61)13-11-26)41(68)57-31(42(69)55-29)20-25-6-2-1-3-7-25/h1-3,6-7,10-13,28-34,61H,4-5,8-9,14-24H2,(H2,47,62)(H2,48,63)(H2,49,64)(H,53,66)(H,54,65)(H,55,69)(H,56,71)(H,57,68)(H,58,67)(H,59,70)(H4,50,51,52)/t28-,29+,30+,31+,32+,33+,34+/m1/s1 |
|
inchikey |
NFLWUMRGJYTJIN-PNIOQBSNSA-N |
|
label |
desmopressin |
|
mass |
1069.21700 |
|
monoisotopicmass |
1068.42696 |
|
notation |
CHEBI:4450 |
|
prefixIRI |
CHEBI:4450 |
|
prefLabel |
desmopressin |
|
smiles |
NC(=N)NCCC[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
|
textual definition |
A synthetic analogue of vasopressin in which 3-mercaptopropionic acid replaces the cysteine residue at position 1 and D-arginine replaces the residue at position 8. An antidiuretic, it increases urine concentration and decreases urine production, and is used (usually as the trihydrate of the acetic acid salt) to prevent and control excessive thirst, urination, and dehydration caused by injury, surgery, and certain medical conditions. It is also used in the diagnosis and treatment of cranial diabetes insipidus and in tests of renal function. |
|
subClassOf |