Preferred Name |
Dexamethasone |
|
Synonyms |
dexamethasone 9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione Dexamethasone Aeroseb-Dex fluormethylprednisolone (11beta,16alpha)-9-fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione 9alpha-fluoro-16alpha-methylprednisolone dexamethasonum Cortisumman dexametasona Millicorten 1-dehydro-16alpha-methyl-9alpha-fluorohydrocortisone 16alpha-methyl-9alpha-fluoro-1-dehydrocortisol Auxiron Azium Calonat Corson Decacort Decadron Decaject Decalix Decameth DexPak Dexacortal Dexacortin Dexason Dexasone Diodex Hexadrol Maxidex Oradexon Ozurdex Solurex Zema-Pak |
|
Definitions |
A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41879 |
|
charge |
0 |
|
database_cross_reference |
PMID:19779450 Patent:GB869511 PMID:32496907 PMID:26602186 Wikipedia:Dexamethasone Patent:US3007923 PMID:20850457 KEGG:C15643 PMID:12151000 HMDB:HMDB0015364 Patent:DE1113690 DrugBank:DB01234 PMID:32195984 PMID:12686538 Drug_Central:824 PMID:31391291 PMID:11508649 PMID:18524938 PMID:32551464 MetaCyc:CPD-10549 Reaxys:2066652 PMID:18272184 PMID:32570995 FooDB:FDB001355 CAS:50-02-2 Beilstein:2066652 PMID:32280693 PMID:29958267 KEGG:D00292 VSDB:1769 |
|
formula |
C22H29FO5 |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_37962 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
has_alternative_id |
CHEBI:41873 CHEBI:4461 |
|
has_exact_synonym |
dexamethasone 9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione Dexamethasone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Aeroseb-Dex fluormethylprednisolone (11beta,16alpha)-9-fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione 9alpha-fluoro-16alpha-methylprednisolone dexamethasone dexamethasonum Cortisumman dexametasona Millicorten 1-dehydro-16alpha-methyl-9alpha-fluorohydrocortisone 16alpha-methyl-9alpha-fluoro-1-dehydrocortisol Auxiron Azium Calonat Corson Decacort Decadron Decaject Decalix Decameth DexPak Dexacortal Dexacortin Dexason Dexasone Diodex Hexadrol Maxidex Oradexon Ozurdex Solurex Zema-Pak |
|
has_RxCUI |
3264 |
|
id |
CHEBI:41879 |
|
in_subset | ||
inchi |
InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
|
inchikey |
UREBDLICKHMUKA-CXSFZGCWSA-N |
|
is bearer of | ||
label |
dexamethasone Dexamethasone |
|
mass |
392.467 |
|
monoisotopicmass |
392.19990 |
|
notation |
CHEBI:41879 |
|
prefixIRI |
CHEBI:41879 |
|
prefLabel |
Dexamethasone |
|
smiles |
C1=CC(C=C2[C@]1([C@@]3([C@@](CC2)([C@]4([C@](C[C@@H]3O)([C@]([C@@H](C4)C)(C(CO)=O)O)C)[H])[H])F)C)=O |
|
textual definition |
A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_77166 http://purl.obolibrary.org/obo/CHEBI_50830 http://purl.obolibrary.org/obo/CHEBI_35344 |