Preferred Name |
Chlorpromazine |
|
Synonyms |
Chlorpromazine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine Chlorderazin N-(3-dimethylaminopropyl)-3-chlorophenothiazine chlorpromazinum 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados Chloropromazine clorpromazina chlorpromazine Aminazine CPZ Contomin Largactil Thorazine |
|
Definitions |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3647 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00270 PMID:1650428 PDBeChem:Z80 PMID:20825390 CAS:50-53-3 KEGG:C06906 Reaxys:289793 Drug_Central:621 Wikipedia:Chlorpromazine LINCS:LSM-4017 PMID:2427628 HMDB:HMDB0014620 PMID:16653219 PMID:7192992 Patent:US2645640 PMID:14354584 PMID:15170372 DrugBank:DB00477 PMID:14404586 Beilstein:289793 |
|
formula |
C17H19ClN2S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37930 http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
has_exact_synonym |
Chlorpromazine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Chlorderazin N-(3-dimethylaminopropyl)-3-chlorophenothiazine chlorpromazinum 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados Chloropromazine clorpromazina chlorpromazine Aminazine CPZ Contomin Largactil Thorazine |
|
has_RxCUI |
2403 |
|
id |
CHEBI:3647 |
|
in_subset | ||
inchi |
InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
|
inchikey |
ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
|
is bearer of | ||
label |
Chlorpromazine chlorpromazine |
|
mass |
318.86400 |
|
monoisotopicmass |
318.09575 |
|
notation |
CHEBI:3647 |
|
prefixIRI |
CHEBI:3647 |
|
prefLabel |
Chlorpromazine |
|
smiles |
CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 |
|
textual definition |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |