Preferred Name |
cefprozil |
|
Synonyms |
(6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Cefprozil anhydrous cefprozilum Cefzil cefprozil cefprozilo |
|
Definitions |
A semisynthetic, second-generation cephalosporin, with prop-1-enyl and (R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. It is used to treat bronchitis as well as ear, skin and other bacterial infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3506 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C06888 KEGG:D07651 DrugBank:DB01150 Wikipedia:Cefprozil Patent:US4520022 CAS:92665-29-7 PMID:29017833 Beilstein:8167198 HMDB:HMDB0015281 Patent:DE3402642 |
|
formula |
C18H19N3O5S |
|
has role | ||
has_exact_synonym |
(6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Cefprozil anhydrous cefprozilum Cefzil cefprozil cefprozilo |
|
has_RxCUI |
19552 |
|
id |
CHEBI:3506 |
|
in_subset | ||
inchi |
InChI=1S/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1 |
|
inchikey |
WDLWHQDACQUCJR-PBFPGSCMSA-N |
|
label |
cefprozil |
|
mass |
389.42600 |
|
monoisotopicmass |
389.10454 |
|
notation |
CHEBI:3506 |
|
prefixIRI |
CHEBI:3506 |
|
prefLabel |
cefprozil |
|
smiles |
[H][C@]12SCC(C=CC)=C(N1C(=O)[C@@]2([H])NC(=O)[C@H](N)c1ccc(O)cc1)C(O)=O |
|
textual definition |
A semisynthetic, second-generation cephalosporin, with prop-1-enyl and (R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. It is used to treat bronchitis as well as ear, skin and other bacterial infections. |
|
subClassOf |