loading...| Preferred Name |
Bumetanide |
|
| Synonyms |
3-butylamino-4-(phenoxy)-5-sulfamoylbenzoic acid 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid bumetanidum 3-(aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid bumetanida bumetanide 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|
| Definitions |
A member of the class of benzoic acids that is 4-phenoxybenzoic acid in which the hydrogens ortho to the phenoxy group are substituted by butylamino and sulfamoyl groups. Bumetanide is a diuretic, and is used for treatment of oedema associated with congestive heart failure, hepatic and renal disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3213 |
|
| alternative term |
3-butylamino-4-(phenoxy)-5-sulfamoylbenzoic acid 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid bumetanidum 3-(aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid bumetanida bumetanide 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
Drug_Central:427 KEGG:D00247 HMDB:HMDB0015024 PMID:18374572 CAS:28395-03-1 Patent:DE1964504 Patent:US3806534 LINCS:LSM-2848 Beilstein:2185351 DrugBank:DB00887 Wikipedia:Bumetanide PMID:19454284 PMID:3989818 PMID:28166217 Patent:DE1964503 Reaxys:2185351 |
|
| formula |
C17H20N2O5S |
|
| has role | ||
| has_alternative_id |
CHEBI:239281 |
|
| has_exact_synonym |
3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-butylamino-4-(phenoxy)-5-sulfamoylbenzoic acid 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid bumetanidum 3-(aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid bumetanida bumetanide |
|
| has_RxCUI |
1808 |
|
| id |
CHEBI:3213 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) |
|
| inchikey |
MAEIEVLCKWDQJH-UHFFFAOYSA-N |
|
| is bearer of | ||
| label |
bumetanide Bumetanide |
|
| mass |
364.41600 |
|
| monoisotopicmass |
364.10929 |
|
| notation |
CHEBI:3213 |
|
| prefixIRI |
CHEBI:3213 |
|
| prefLabel |
Bumetanide |
|
| smiles |
CCCCNc1cc(cc(c1Oc1ccccc1)S(N)(=O)=O)C(O)=O |
|
| textual definition |
A member of the class of benzoic acids that is 4-phenoxybenzoic acid in which the hydrogens ortho to the phenoxy group are substituted by butylamino and sulfamoyl groups. Bumetanide is a diuretic, and is used for treatment of oedema associated with congestive heart failure, hepatic and renal disease. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22723 |