Preferred Name |
oleate |
|
Synonyms |
(9Z)-octadec-9-enoate (9Z)-octadecenoate oleic acid anion cis-9-octadecenoate (Z)-9-octadecenoic acid, ion(1-) Oleat |
|
Definitions |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30823 |
|
charge |
-1 |
|
database_cross_reference |
Reaxys:1913148 Beilstein:1913148 CAS:115-06-0 PMID:12429352 Gmelin:344067 |
|
formula |
C18H33O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:25663 CHEBI:14684 |
|
has_exact_synonym |
(9Z)-octadec-9-enoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(9Z)-octadecenoate oleic acid anion cis-9-octadecenoate (Z)-9-octadecenoic acid, ion(1-) Oleat |
|
has_RxCUI |
70616 |
|
id |
CHEBI:30823 |
|
in_subset | ||
inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9- |
|
inchikey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-M |
|
is conjugate base of | ||
label |
oleate Oleate |
|
mass |
281.45342 |
|
monoisotopicmass |
281.24860 |
|
notation |
CHEBI:30823 |
|
prefixIRI |
CHEBI:30823 |
|
prefLabel |
oleate |
|
smiles |
CCCCCCCC\C=C/CCCCCCCC([O-])=O |
|
textual definition |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
subClassOf |