Preferred Name |
salicylic acid |
|
Synonyms |
2-hydroxybenzoic acid Salicylic acid o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid |
|
Definitions |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
charge |
0 |
|
database_cross_reference |
PMID:12865403 LINCS:LSM-4763 PMID:1650428 HMDB:HMDB0001895 Reaxys:774890 PMID:29079364 PMID:19400653 KEGG:D00097 PMID:19816125 Wikipedia:Salicylic_Acid PMID:11016405 PMID:32807953 PDBeChem:SAL DrugBank:DB00936 CAS:69-72-7 Drug_Central:2416 MetaCyc:CPD-110 KNApSAcK:C00000206 PMID:3425858 PMID:22770225 KEGG:C00805 Gmelin:3418 Beilstein:774890 |
|
formula |
C7H6O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_35441 http://purl.obolibrary.org/obo/CHEBI_37848 http://purl.obolibrary.org/obo/CHEBI_50176 http://purl.obolibrary.org/obo/CHEBI_73181 |
|
has_alternative_id |
CHEBI:26597 CHEBI:45521 CHEBI:9006 |
|
has_exact_synonym |
2-hydroxybenzoic acid Salicylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid |
|
has_RxCUI |
9525 |
|
id |
CHEBI:16914 |
|
in_subset | ||
inchi |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
|
inchikey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
salicylic acid Salicylic Acid |
|
mass |
138.12070 |
|
monoisotopicmass |
138.03169 |
|
notation |
CHEBI:16914 |
|
prefixIRI |
CHEBI:16914 |
|
prefLabel |
salicylic acid |
|
smiles |
OC(=O)c1ccccc1O |
|
textual definition |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
subClassOf |