Preferred Name |
Selegiline |
|
Synonyms |
N-methyl-N-(1-methyl-2-phenylethyl)prop-2-yn-1-amine CC(Cc1ccccc1)N(C)CC#C selegiline selegilina InChIKey=MEZLKOACVSPNER-UHFFFAOYSA-N C13H17N selegilinum InChI=1S/C13H17N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,5-9,12H,10-11H2,2-3H3 |
|
Definitions |
A phenethylamine alkaloid that has formula C13H17N. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50217 |
|
database_cross_reference |
Beilstein:2092580 |
|
definition |
A phenethylamine alkaloid that has formula C13H17N. |
|
has_exact_synonym |
N-methyl-N-(1-methyl-2-phenylethyl)prop-2-yn-1-amine |
|
has_related_synonym |
CC(Cc1ccccc1)N(C)CC#C selegiline selegilina InChIKey=MEZLKOACVSPNER-UHFFFAOYSA-N C13H17N selegilinum InChI=1S/C13H17N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,5-9,12H,10-11H2,2-3H3 |
|
has_RxCUI |
9639 |
|
id |
CHEBI:50217 |
|
imported from | ||
label |
Selegiline selegiline |
|
notation |
CHEBI:50217 |
|
prefLabel |
Selegiline |
|
subClassOf |
Create mapping