Preferred Name |
oleic acid |
|
Synonyms |
OLEIC ACID (9Z)-octadec-9-enoic acid Oleic acid (9Z)-Octadecenoic acid Oleate cis-Delta(9)-octadecenoic acid 282.46140 Octadec-9-enoic acid C18:1 n-9 CCCCCCCC\C=C/CCCCCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- 18:1Delta9cis ZQPPMHVWECSIRJ-KTKRTIGZSA-N 18:1 n-9 C18H34O2 (Z)-Octadec-9-enoic acid Oelsaeure cis-9-octadecenoic acid cis-oleic acid |
|
Definitions |
An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16196 |
|
database_cross_reference |
Reaxys:1726542 PMID:15325315 PDBeChem:OLA KNApSAcK:C00001232 Wikipedia:Oleic_acid PMID:24819471 PMID:6205897 PMID:5332408 DrugBank:DB04224 CAS:112-80-1 Gmelin:57556 Beilstein:1726542 PMID:23844805 PMID:19761868 PMID:18772370 HMDB:HMDB00207 KEGG:C00712 Gmelin:109551 LIPID_MAPS_instance:LMFA01030002 ECMDB:ECMDB21348 KEGG:D02315 PMID:15723125 PMID:11304127 PMID:25794012 |
|
definition |
An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_83038 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_46787 http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:104361 CHEBI:7741 CHEBI:25664 CHEBI:44741 |
|
has_exact_synonym |
OLEIC ACID (9Z)-octadec-9-enoic acid Oleic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(9Z)-Octadecenoic acid Oleate cis-Delta(9)-octadecenoic acid 282.46140 Octadec-9-enoic acid C18:1 n-9 CCCCCCCC\C=C/CCCCCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- 18:1Delta9cis ZQPPMHVWECSIRJ-KTKRTIGZSA-N 18:1 n-9 C18H34O2 (Z)-Octadec-9-enoic acid Oelsaeure cis-9-octadecenoic acid cis-oleic acid |
|
id |
CHEBI:16196 |
|
imported from | ||
is conjugate acid of | ||
label |
oleic acid |
|
notation |
CHEBI:16196 |
|
prefLabel |
oleic acid |
|
subClassOf |