Preferred Name |
naringenin |
|
Synonyms |
272.25278 FTVWIRXFELQLPI-UHFFFAOYSA-N Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2 C15H12O5 5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
|
Definitions |
A trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50202 |
|
database_cross_reference |
MetaCyc:Naringenin Beilstein:280888 LINCS:LSM-1927 |
|
definition |
A trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. |
|
has_exact_synonym |
5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
272.25278 FTVWIRXFELQLPI-UHFFFAOYSA-N Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2 C15H12O5 |
|
id |
CHEBI:50202 |
|
imported from | ||
label |
naringenin |
|
notation |
CHEBI:50202 |
|
prefLabel |
naringenin |
|
subClassOf |