loading...| Preferred Name |
acetate |
|
| Synonyms |
acetate CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M CH3-COO(-) Azetat MeCO2 anion acetic acid, ion(1-) ethanoate C2H3O2 59.04402 InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 ACETATE ION Ethanoat |
|
| Definitions |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30089 |
|
| database_cross_reference |
PDBeChem:ACT PMID:22371380 Gmelin:1379 MetaCyc:ACET CAS:71-50-1 KEGG:C00033 DrugBank:DB03166 Wikipedia:Acetate PMID:17190852 Reaxys:1901470 PMID:22211106 UM-BBD_compID:c0050 Beilstein:1901470 |
|
| definition |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
| has role | ||
| has_alternative_id |
CHEBI:22165 CHEBI:13704 CHEBI:40480 |
|
| has_exact_synonym |
acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M CH3-COO(-) Azetat MeCO2 anion acetic acid, ion(1-) ethanoate C2H3O2 59.04402 InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 ACETATE ION Ethanoat |
|
| id |
CHEBI:30089 |
|
| imported from | ||
| is conjugate base of | ||
| label |
acetate |
|
| notation |
CHEBI:30089 |
|
| prefLabel |
acetate |
|
| subClassOf |