loading...| Preferred Name |
sulfasalazine |
|
| Synonyms |
|
|
| Definitions |
An azobenzene consisting of diphenyldiazene having a carboxy substituent at the 4-position, a hydroxy substituent at the 3-position and a 2-pyridylaminosulphonyl substituent at the 4'-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9334 |
|
| charge |
0 |
|
| definition |
An azobenzene consisting of diphenyldiazene having a carboxy substituent at the 4-position, a hydroxy substituent at the 3-position and a 2-pyridylaminosulphonyl substituent at the 4'-position. |
|
| formula |
C18H14N4O5S |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76797 http://purl.obolibrary.org/obo/CHEBI_55324 http://purl.obolibrary.org/obo/CHEBI_35441 http://purl.obolibrary.org/obo/CHEBI_173085 |
|
| has_functional_parent | ||
| inchi |
InChI=1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,23H,(H,19,22)(H,24,25)/b21-20+ |
|
| inchikey |
NCEXYHBECQHGNR-QZQOTICOSA-N |
|
| label |
sulfasalazine |
|
| mass |
398.39300 |
|
| monoisotopicmass |
398.06849 |
|
| prefixIRI |
CHEBI:9334 |
|
| prefLabel |
sulfasalazine |
|
| smiles |
OC(=O)c1cc(ccc1O)\N=N\c1ccc(cc1)S(=O)(=O)Nc1ccccn1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |