Preferred Name |
candesartan |
|
Synonyms |
|
|
Definitions |
A benzimidazolecarboxylic acid that is 1H-benzimidazole-7-carboxylic acid substituted by an ethoxy group at position 2 and a ({2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl}methyl) group at position 1. It is a angiotensin receptor antagonist used for the treatment of hypertension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3347 |
|
charge |
0 |
|
definition |
A benzimidazolecarboxylic acid that is 1H-benzimidazole-7-carboxylic acid substituted by an ethoxy group at position 2 and a ({2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl}methyl) group at position 1. It is a angiotensin receptor antagonist used for the treatment of hypertension. |
|
formula |
C24H20N6O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_61016 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
inchi |
InChI=1S/C24H20N6O3/c1-2-33-24-25-20-9-5-8-19(23(31)32)21(20)30(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-26-28-29-27-22/h3-13H,2,14H2,1H3,(H,31,32)(H,26,27,28,29) |
|
inchikey |
HTQMVQVXFRQIKW-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
label |
candesartan |
|
mass |
440.45424 |
|
monoisotopicmass |
440.15969 |
|
prefixIRI |
CHEBI:3347 |
|
prefLabel |
candesartan |
|
smiles |
CCOc1nc2cccc(C(O)=O)c2n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1 |
|
subClassOf |