Preferred Name |
oxaliplatin |
|
Synonyms |
|
|
Definitions |
A platinum coordination entity that is a commonly used chemothrepeutic drug for treatment of colorectal cancer. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31941 |
|
charge |
0 |
|
definition |
A platinum coordination entity that is a commonly used chemothrepeutic drug for treatment of colorectal cancer. |
|
formula |
C8H14N2O4Pt C6H14N2.C2O4.Pt |
|
has role | ||
inchi |
InChI=1S/C6H14N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-6H,1-4,7-8H2;(H,3,4)(H,5,6);/q;;+2/p-2/t5-,6-;;/m1../s1 |
|
inchikey |
ZROHGHOFXNOHSO-BNTLRKBRSA-L |
|
label |
oxaliplatin |
|
mass |
397.28584 |
|
monoisotopicmass |
397.06015 |
|
prefixIRI |
CHEBI:31941 |
|
prefLabel |
oxaliplatin |
|
smiles |
[H][N]1([H])[C@@H]2CCCC[C@H]2[N]([H])([H])[Pt]11OC(=O)C(=O)O1 |
|
subClassOf |
Create mapping