Jump to:
loading...| Preferred Name |
linoleate |
|
| Synonyms |
|
|
| Definitions |
An octadecadienoate with cis- double bonds at the 9- and 12- positions; the conjugate base of linoleic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30245 |
|
| charge |
-1 |
|
| definition |
An octadecadienoate with cis- double bonds at the 9- and 12- positions; the conjugate base of linoleic acid. |
|
| formula |
C18H31O2 |
|
| has role | ||
| has_functional_parent | ||
| inchi |
InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9- |
|
| inchikey |
OYHQOLUKZRVURQ-HZJYTTRNSA-M |
|
| is_conjugate_base_of | ||
| label |
linoleate |
|
| mass |
279.43754 |
|
| monoisotopicmass |
279.23295 |
|
| prefixIRI |
CHEBI:30245 |
|
| prefLabel |
linoleate |
|
| smiles |
CCCCC\C=C/C\C=C/CCCCCCCC([O-])=O |
|
| subClassOf |
Create mapping