Preferred Name |
serine |
|
Synonyms |
|
|
Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
charge |
0 |
|
definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
formula |
C3H7NO3 |
|
has part | ||
has role | ||
inchi |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
|
inchikey |
MTCFGRXMJLQNBG-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
is_tautomer_of | ||
label |
serine |
|
mass |
105.09262 |
|
monoisotopicmass |
105.04259 |
|
prefixIRI |
CHEBI:17822 |
|
prefLabel |
serine |
|
smiles |
NC(CO)C(O)=O |
|
subClassOf |
Create mapping