Jump to:
loading...| Preferred Name |
propionate |
|
| Synonyms |
|
|
| Definitions |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17272 |
|
| charge |
-1 |
|
| definition |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
| formula |
C3H5O2 |
|
| has role | ||
| inchi |
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 |
|
| inchikey |
XBDQKXXYIPTUBI-UHFFFAOYSA-M |
|
| is_conjugate_base_of | ||
| label |
propionate |
|
| mass |
73.07060 |
|
| monoisotopicmass |
73.02950 |
|
| prefixIRI |
CHEBI:17272 |
|
| prefLabel |
propionate |
|
| smiles |
CCC([O-])=O |
|
| subClassOf |
Create mapping