Preferred Name |
arachidonic acid |
|
Synonyms |
|
|
Definitions |
A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15843 |
|
charge |
0 |
|
definition |
A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
formula |
C20H32O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_83038 |
|
has_parent_hydride | ||
inchi |
InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15- |
|
inchikey |
YZXBAPSDXZZRGB-DOFZRALJSA-N |
|
is_conjugate_acid_of | ||
label |
arachidonic acid |
|
mass |
304.46690 |
|
monoisotopicmass |
304.24023 |
|
prefixIRI |
CHEBI:15843 |
|
prefLabel |
arachidonic acid |
|
smiles |
CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O |
|
subClassOf |
Create mapping