Jump to:
loading...| Preferred Name |
icosa-5,8,11,14-tetraenoic acid |
|
| Synonyms |
|
|
| Definitions |
Any icosatetraenoic acid with the double bonds at positions 5, 8, 11 and 14. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36306 |
|
| charge |
0 |
|
| definition |
Any icosatetraenoic acid with the double bonds at positions 5, 8, 11 and 14. |
|
| formula |
C20H32O2 |
|
| inchi |
InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22) |
|
| inchikey |
YZXBAPSDXZZRGB-UHFFFAOYSA-N |
|
| label |
icosa-5,8,11,14-tetraenoic acid |
|
| mass |
304.46688 |
|
| monoisotopicmass |
304.24023 |
|
| prefixIRI |
CHEBI:36306 |
|
| prefLabel |
icosa-5,8,11,14-tetraenoic acid |
|
| smiles |
[H]C(CCCC(O)=O)=CCC([H])=CCC([H])=CCC([H])=CCCCCC |
|
| subClassOf |
Create mapping