loading...| Preferred Name |
L-dopa |
|
| Synonyms |
|
|
| Definitions |
An optically active form of dopa having L-configuration. Used to treat the stiffness, tremors, spasms, and poor muscle control of Parkinson's disease |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15765 |
|
| charge |
0 |
|
| definition |
An optically active form of dopa having L-configuration. Used to treat the stiffness, tremors, spasms, and poor muscle control of Parkinson's disease |
|
| formula |
C9H11NO4 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_59174 http://purl.obolibrary.org/obo/CHEBI_50910 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_62215 http://purl.obolibrary.org/obo/CHEBI_35219 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_59174 http://purl.obolibrary.org/obo/CHEBI_50910 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_62215 http://purl.obolibrary.org/obo/CHEBI_35219 |
|
| inchi |
InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1 |
|
| inchikey |
WTDRDQBEARUVNC-LURJTMIESA-N |
|
| is_conjugate_acid_of | ||
| is_enantiomer_of | ||
| is_tautomer_of | ||
| label |
L-dopa |
|
| mass |
197.18798 |
|
| monoisotopicmass |
197.06881 |
|
| prefixIRI |
CHEBI:15765 |
|
| prefLabel |
L-dopa |
|
| smiles |
N[C@@H](Cc1ccc(O)c(O)c1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_49168 |