loading...| Preferred Name |
oxandrolone |
|
| Synonyms |
Oxandrolone 17beta-hydroxy-17alpha-methyl-2-oxa-5alpha-androstan-3-one oxandrolona oxandrolone oxandrolonum Vasorome Oxandrolona (INN-Spanish) Provitar Ossandrolone (DCIT) Anavar Oxandrolonum (INN-Latin) Oxandrin Lonavar Protivar |
|
| Definitions |
A synthetic hormone with anabolic and androgenic properties. (PubChem) Pharmacology: Oxandrolone is an anabolic steroids indicated as adjunctive therapy to promote weight gain after weight loss following extensive surgery, chronic infections, or severe trauma, and in some patients who without definite pathophysiologic reasons fail to gain or to maintain normal weight, to offset the protein catabolism associated with prolonged administration of corticosteroids, and for the relief of the bone pain frequently accompanying osteoporosis. Anabolic steroids are synthetic derivatives of testosterone. Mechanism of action: Oxandrolones interact with androgen receptors in target tissues. Drug type: Approved. Investigational. Small Molecule. Drug category: Anabolic Agents. Androgens |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7820 |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
KEGG:D00462 Beilstein:5480667 Wikipedia:Oxandrolone Drug_Central:2011 DrugBank:DB00621 |
|
| definition |
A synthetic hormone with anabolic and androgenic properties. (PubChem) Pharmacology: Oxandrolone is an anabolic steroids indicated as adjunctive therapy to promote weight gain after weight loss following extensive surgery, chronic infections, or severe trauma, and in some patients who without definite pathophysiologic reasons fail to gain or to maintain normal weight, to offset the protein catabolism associated with prolonged administration of corticosteroids, and for the relief of the bone pain frequently accompanying osteoporosis. Anabolic steroids are synthetic derivatives of testosterone. Mechanism of action: Oxandrolones interact with androgen receptors in target tissues. Drug type: Approved. Investigational. Small Molecule. Drug category: Anabolic Agents. Androgens |
|
| formula |
C19H30O3 |
|
| has characteristic | ||
| has exact synonym |
Oxandrolone 17beta-hydroxy-17alpha-methyl-2-oxa-5alpha-androstan-3-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
oxandrolona oxandrolone oxandrolonum |
|
| hasExternalSource |
DB00621 |
|
| id |
CHEBI:7820 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H30O3/c1-17-11-22-16(20)10-12(17)4-5-13-14(17)6-8-18(2)15(13)7-9-19(18,3)21/h12-15,21H,4-11H2,1-3H3/t12-,13+,14-,15-,17-,18-,19-/m0/s1 |
|
| inchikey |
QSLJIVKCVHQPLV-PEMPUTJUSA-N |
|
| label |
oxandrolone |
|
| mass |
306.43970 |
|
| modifiedDate |
May 21, 2010 |
|
| monoisotopicmass |
306.21949 |
|
| notation |
CHEBI:7820 |
|
| prefLabel |
oxandrolone |
|
| smiles |
[H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)[C@@]1(C)COC(=O)C2 |
|
| synonym |
Vasorome Oxandrolona (INN-Spanish) Provitar Ossandrolone (DCIT) Anavar Oxandrolonum (INN-Latin) Oxandrin Lonavar Protivar |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47788 http://purl.obolibrary.org/obo/CHEBI_35343 http://uri.neuinfo.org/nif/nifstd/nlx_chem_1003011 |