Jump to:
loading...| Preferred Name |
sulfonic acid |
|
| Synonyms |
sulfonic acid hydridohydroxidodioxidosulfur sulphonic acid acide sulfonique HSHO3 [SHO2(OH)] Sulfonsaeure |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29214 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:1404640 |
|
| formula |
H2O3S |
|
| has exact synonym |
sulfonic acid hydridohydroxidodioxidosulfur |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
sulphonic acid acide sulfonique HSHO3 [SHO2(OH)] Sulfonsaeure |
|
| id |
CHEBI:29214 |
|
| in_subset | ||
| inchi |
InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3) |
|
| inchikey |
BDHFUVZGWQCTTF-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
sulfonic acid |
|
| mass |
82.08008 |
|
| monoisotopicmass |
81.97247 |
|
| notation |
CHEBI:29214 |
|
| prefLabel |
sulfonic acid |
|
| smiles |
[H]S(O)(=O)=O |
|
| subClassOf |
Create mapping