Preferred Name |
trimethobenzamide |
|
Synonyms |
trimethobenzamide trimetobenzamida N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide trimethobenzamidum N-{4-[2-(dimethylamino)ethoxy]benzyl}-3,4,5-trimethoxybenzamide |
|
Definitions |
The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27796 |
|
alternative label |
trimethobenzamide trimetobenzamida N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide trimethobenzamidum N-{4-[2-(dimethylamino)ethoxy]benzyl}-3,4,5-trimethoxybenzamide |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:2754 KEGG:C07178 Wikipedia:Trimethobenzamide LINCS:LSM-2750 Beilstein:2186451 DrugBank:DB00662 KEGG:D08643 CAS:138-56-7 |
|
definition |
The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
|
formula |
C21H28N2O5 |
|
has characteristic | ||
has exact synonym |
N-{4-[2-(dimethylamino)ethoxy]benzyl}-3,4,5-trimethoxybenzamide |
|
has role | ||
has_alternative_id |
CHEBI:9730 CHEBI:27123 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
trimethobenzamide trimetobenzamida N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide trimethobenzamidum |
|
id |
CHEBI:27796 |
|
in_subset | ||
inchi |
InChI=1S/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24) |
|
inchikey |
FEZBIKUBAYAZIU-UHFFFAOYSA-N |
|
label |
trimethobenzamide |
|
mass |
388.45740 |
|
monoisotopicmass |
388.19982 |
|
notation |
CHEBI:27796 |
|
note |
The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
|
preferred label |
trimethobenzamide |
|
prefLabel |
trimethobenzamide |
|
smiles |
COc1cc(cc(OC)c1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 |
|
subClassOf |