Preferred Name |
phosphorous acid |
|
Synonyms |
trioxophosphoric(3-) acid trihydrogen trioxophosphate(3-) trihydroxidophosphorus phosphorous acid 81.99578 phosphorige Saeure OJMIONKXNSYLSR-UHFFFAOYSA-N H3O3P P(OH)3 H3PO3 phosphite InChI=1S/H3O3P/c1-4(2)3/h1-3H 81.982 0 [P(OH)3] [H]OP(O[H])O[H] |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36361 |
|
database_cross_reference |
Gmelin:164068 CAS:10294-56-1 |
|
has exact synonym |
trioxophosphoric(3-) acid trihydrogen trioxophosphate(3-) trihydroxidophosphorus phosphorous acid |
|
has_alternative_id |
CHEBI:29196 CHEBI:26081 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
81.99578 phosphorige Saeure OJMIONKXNSYLSR-UHFFFAOYSA-N H3O3P P(OH)3 H3PO3 phosphite InChI=1S/H3O3P/c1-4(2)3/h1-3H 81.982 0 [P(OH)3] [H]OP(O[H])O[H] |
|
id |
CHEBI:36361 |
|
in_subset | ||
is conjugate acid of | ||
is tautomer of | ||
label |
phosphorous acid |
|
notation |
CHEBI:36361 |
|
prefLabel |
phosphorous acid |
|
subClassOf |
Create mapping