Preferred Name |
propionate |
|
Synonyms |
propionate propanoate 73.029 metacetonate EtCO2 anion C3H5O2 ethylformate InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 CCC([O-])=O 73.07060 propanoic acid, ion(1-) ethanecarboxylate pseudoacetate XBDQKXXYIPTUBI-UHFFFAOYSA-M -1 CH3-CH2-COO(-) carboxylatoethane propanate methylacetate |
|
Definitions |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17272 |
|
database_cross_reference |
KEGG:C00163 PMID:17951291 Gmelin:1820 UM-BBD_compID:c0277 CAS:72-03-7 Beilstein:3587503 PMID:18375549 PMID:2647392 |
|
has exact synonym |
propionate propanoate |
|
has role | ||
has_alternative_id |
CHEBI:26290 CHEBI:14903 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
73.029 metacetonate EtCO2 anion C3H5O2 ethylformate InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 CCC([O-])=O 73.07060 propanoic acid, ion(1-) ethanecarboxylate pseudoacetate XBDQKXXYIPTUBI-UHFFFAOYSA-M -1 CH3-CH2-COO(-) carboxylatoethane propanoate propanate methylacetate |
|
id |
CHEBI:17272 |
|
in_subset | ||
is conjugate base of | ||
label |
propionate |
|
notation |
CHEBI:17272 |
|
prefLabel |
propionate |
|
textual definition |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
subClassOf |