Preferred Name |
aldose |
|
Synonyms |
Aldose aldoses InChIKey=MNQZXJOMYWMBOU-UHFFFAOYSA-N an aldose C2H4O2(CH2O)n InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2 |
|
Definitions |
Aldehydic parent sugars (polyhydroxy aldehydes H[CH(OH)]nC(=O)H, n >= 2) and their intramolecular hemiacetals. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15693 |
|
database_cross_reference |
KEGG COMPOUND:C01370 |
|
definition |
Aldehydic parent sugars (polyhydroxy aldehydes H[CH(OH)]nC(=O)H, n >= 2) and their intramolecular hemiacetals. |
|
has_alternative_id |
CHEBI:22305 CHEBI:2561 CHEBI:13755 |
|
has_exact_synonym |
Aldose |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
aldoses InChIKey=MNQZXJOMYWMBOU-UHFFFAOYSA-N an aldose C2H4O2(CH2O)n InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2 |
|
id |
CHEBI:15693 |
|
imported from | ||
label |
aldose |
|
notation |
CHEBI:15693 |
|
prefLabel |
aldose |
|
subClassOf |
Create mapping