Jump to:
loading...| Preferred Name |
valproate |
|
| Synonyms |
2-propylpentanoate 2-propylvalerate dipropylacetate |
|
| Definitions |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_60654 |
|
| charge |
-1 |
|
| database_cross_reference |
PMID:21243535 PMID:20633966 PMID:21629819 PMID:21472635 PMID:21767635 PMID:21167688 PMID:21459656 PMID:21593515 PMID:21454832 PMID:21161183 LINCS:LSM-6363 PMID:8681902 PMID:16012283 |
|
| definition |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
|
| formula |
C8H15O2 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:68615 |
|
| has_exact_synonym |
2-propylpentanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-propylvalerate dipropylacetate |
|
| id |
CHEBI:60654 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
|
| inchikey |
NIJJYAXOARWZEE-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
valproate |
|
| mass |
143.20350 |
|
| monoisotopicmass |
143.10775 |
|
| notation |
CHEBI:60654 |
|
| prefLabel |
valproate |
|
| smiles |
CCCC(CCC)C([O-])=O |
|
| subClassOf |
Create mapping