Preferred Name |
valproate |
|
Synonyms |
2-propylpentanoate 2-propylvalerate dipropylacetate |
|
Definitions |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_60654 |
|
charge |
-1 |
|
database_cross_reference |
PMID:21243535 PMID:20633966 PMID:21629819 PMID:21472635 PMID:21767635 PMID:21167688 PMID:21459656 PMID:21593515 PMID:21454832 PMID:21161183 LINCS:LSM-6363 PMID:8681902 PMID:16012283 |
|
definition |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
|
formula |
C8H15O2 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:68615 |
|
has_exact_synonym |
2-propylpentanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-propylvalerate dipropylacetate |
|
id |
CHEBI:60654 |
|
in_subset | ||
inchi |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
|
inchikey |
NIJJYAXOARWZEE-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
valproate |
|
mass |
143.20350 |
|
monoisotopicmass |
143.10775 |
|
notation |
CHEBI:60654 |
|
prefLabel |
valproate |
|
smiles |
CCCC(CCC)C([O-])=O |
|
subClassOf |
Create mapping