Preferred Name |
metoprolol |
|
Synonyms |
1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol Metoprolol (RS)-Metoprolol 1-(isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
|
Definitions |
A propanolamine that is 1-(propan-2-ylamino)propan-2-ol substituted by a 4-(2-methoxyethyl)phenoxy group at position 1. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6904 |
|
charge |
0 |
|
database_cross_reference |
MeSH:D008790 NCIt:C61845 SNOMEDCT:372826007 SNOMEDCT:7092007 CAS:51384-51-1 Wikipedia:Metoprolol Drug_Central:1786 HMDB:HMDB0001932 LINCS:LSM-1259 PMID:23314750 PMID:24025984 KEGG:D02358 KEGG:C07202 PMID:15797646 CAS:37350-58-6 Reaxys:1117585 DrugBank:DB00264 PMID:15140634 |
|
definition |
A propanolamine that is 1-(propan-2-ylamino)propan-2-ol substituted by a 4-(2-methoxyethyl)phenoxy group at position 1. |
|
formula |
C15H25NO3 |
|
has_exact_synonym |
1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol Metoprolol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(RS)-Metoprolol 1-(isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
|
has_role | ||
id |
CHEBI:6904 |
|
in_subset | ||
inchi |
InChI=1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 |
|
inchikey |
IUBSYMUCCVWXPE-UHFFFAOYSA-N |
|
label |
metoprolol |
|
mass |
267.36394 |
|
monoisotopicmass |
267.18344 |
|
notation |
CHEBI:6904 |
|
prefLabel |
metoprolol |
|
smiles |
COCCc1ccc(OCC(O)CNC(C)C)cc1 |
|
subClassOf |