Preferred Name |
ketamine |
|
Synonyms |
Ketamine 2-(2-chlorophenyl)-2-(methylamino)cyclohexanone KETAMINE ketamine ketamina (+-)-ketamine 2-(methylamino)-2-(2-chlorophenyl)cyclohexanone NMDA 2-(o-chlorophenyl)-2-(methylamino)-cyclohexanone special K ketaminum 2-(2-Chloro-phenyl)-2-methylamino-cyclohexanone dl-ketamine DL-ketamine |
|
Definitions |
A member of the class of cyclohexanones in which one of the hydrogens at position 2 is substituted by a 2-chlorophenyl group, while the other is substituted by a methylamino group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6121 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:1523 CAS:100477-72-3 HMDB:HMDB0015352 DrugBank:DB01221 Wikipedia:Ketamine Patent:BE634208 CAS:6740-88-1 Patent:US3254124 VSDB:2978 Reaxys:2216965 KEGG:D08098 KEGG:C07525 PMID:3783598 |
|
definition |
A member of the class of cyclohexanones in which one of the hydrogens at position 2 is substituted by a 2-chlorophenyl group, while the other is substituted by a methylamino group. |
|
formula |
C13H16ClNO |
|
has_alternative_id |
CHEBI:138833 |
|
has_exact_synonym |
Ketamine 2-(2-chlorophenyl)-2-(methylamino)cyclohexanone KETAMINE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ketamine ketamina (+-)-ketamine 2-(methylamino)-2-(2-chlorophenyl)cyclohexanone NMDA 2-(o-chlorophenyl)-2-(methylamino)-cyclohexanone special K ketaminum 2-(2-Chloro-phenyl)-2-methylamino-cyclohexanone dl-ketamine DL-ketamine |
|
id |
CHEBI:6121 |
|
in_subset | ||
inchi |
InChI=1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 |
|
inchikey |
YQEZLKZALYSWHR-UHFFFAOYSA-N |
|
label |
ketamine |
|
mass |
237.72500 |
|
monoisotopicmass |
237.09204 |
|
notation |
CHEBI:6121 |
|
prefLabel |
ketamine |
|
smiles |
CNC1(CCCCC1=O)c1ccccc1Cl |
|
subClassOf |