Preferred Name |
clozapine |
|
Synonyms |
8-chloro-11-(4-methylpiperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine Clozapine clozapina Clozapin clozapine clozapinum |
|
Definitions |
A benzodiazepine that is 5H-dibenzo[b,e][1,4]diazepine substituted by a chloro group at position 8 and a 4-methylpiperazin-1-yl group at position 11. It is a second generation antipsychotic used in the treatment of psychiatric disorders like schizophrenia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3766 |
|
charge |
0 |
|
database_cross_reference |
NCIt:C28936 SNOMEDCT:96221003 SNOMEDCT:387568001 KEGG COMPOUND:C06924 KEGG DRUG:D00283 MeSH:D003024 ChemIDplus:5786-21-0 ChEMBL:102261 Beilstein:0764984 HMDB:HMDB0014507 KEGG:D00283 Drug_Central:722 Patent:US3539573 Wikipedia:Clozapine PMID:18690109 DrugBank:DB00363 PMID:20825390 Reaxys:764984 PMID:24219174 Patent:FR1334944 CAS:5786-21-0 KEGG:C06924 PMID:18766167 Patent:NL293201 |
|
definition |
A benzodiazepine that is 5H-dibenzo[b,e][1,4]diazepine substituted by a chloro group at position 8 and a 4-methylpiperazin-1-yl group at position 11. It is a second generation antipsychotic used in the treatment of psychiatric disorders like schizophrenia. |
|
formula |
C18H19ClN4 |
|
has_exact_synonym |
8-chloro-11-(4-methylpiperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine Clozapine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clozapina Clozapin clozapine clozapinum |
|
has_role |
http://purl.obolibrary.org/obo/CHEBI_37887 http://purl.obolibrary.org/obo/CHEBI_37956 http://purl.obolibrary.org/obo/CHEBI_48876 http://purl.obolibrary.org/obo/CHEBI_48561 |
|
id |
CHEBI:3766 |
|
in_subset | ||
inchi |
InChI=1S/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3 |
|
inchikey |
QZUDBNBUXVUHMW-UHFFFAOYSA-N |
|
label |
clozapine |
|
mass |
326.824 |
|
monoisotopicmass |
326.12982 |
|
notation |
CHEBI:3766 |
|
prefLabel |
clozapine |
|
smiles |
N1=C(C2=CC=CC=C2NC3=CC=C(C=C13)Cl)N4CCN(CC4)C |
|
subClassOf |