Preferred Name |
serine |
|
Synonyms |
Serine serine Serin 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid 2-Amino-3-hydroxypropionic acid |
|
Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1721402 Gmelin:26429 CAS:302-84-1 Reaxys:1721402 KNApSAcK:C00001393 Wikipedia:Serine KEGG:C00716 |
|
definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
formula |
C3H7NO3 |
|
has_alternative_id |
CHEBI:26648 CHEBI:15081 CHEBI:9116 |
|
has_exact_synonym |
Serine serine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Serin 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid 2-Amino-3-hydroxypropionic acid |
|
id |
CHEBI:17822 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
|
inchikey |
MTCFGRXMJLQNBG-UHFFFAOYSA-N |
|
label |
serine |
|
mass |
105.09262 |
|
monoisotopicmass |
105.04259 |
|
notation |
CHEBI:17822 |
|
prefLabel |
serine |
|
smiles |
NC(CO)C(O)=O |
|
subClassOf |
Create mapping