loading...| Preferred Name |
kinetin |
|
| Synonyms |
kinetin N-(furan-2-ylmethyl)-7H-purin-6-amine N(6)-furfuryladenine 6-(furfurylamino)purine 6-furfuryladenine N-furfuryladenine N(6)-(furfurylamino)purine |
|
| Definitions |
A member of the class of 6-aminopurines that is adenine carrying a (furan-2-ylmethyl) substituent at the exocyclic amino group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27407 |
|
| charge |
0 |
|
| database_cross_reference |
PDBeChem:H35 PMID:23143313 KNApSAcK:C00001504 BPDB:1628 PMID:23963070 PMID:7488181 FooDB:FDB028887 Wikipedia:Kinetin PMID:23179712 Pesticides:kinetin DrugBank:DB11336 Drug_Central:3976 Reaxys:21703 HMDB:HMDB0012245 CAS:525-79-1 MetaCyc:CPD-4609 LINCS:LSM-5740 KEGG:C08272 |
|
| definition |
A member of the class of 6-aminopurines that is adenine carrying a (furan-2-ylmethyl) substituent at the exocyclic amino group. |
|
| formula |
C10H9N5O |
|
| has_alternative_id |
CHEBI:24987 CHEBI:10584 CHEBI:43130 |
|
| has_exact_synonym |
kinetin N-(furan-2-ylmethyl)-7H-purin-6-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N(6)-furfuryladenine 6-(furfurylamino)purine 6-furfuryladenine N-furfuryladenine N(6)-(furfurylamino)purine |
|
| id |
CHEBI:27407 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) |
|
| inchikey |
QANMHLXAZMSUEX-UHFFFAOYSA-N |
|
| label |
kinetin |
|
| mass |
215.21140 |
|
| monoisotopicmass |
215.08071 |
|
| notation |
CHEBI:27407 |
|
| prefLabel |
kinetin |
|
| smiles |
C(Nc1ncnc2nc[nH]c12)c1ccco1 |
|
| subClassOf |