loading...| Preferred Name |
deoxycholic acid |
|
| Synonyms |
Deoxycholic acid 3alpha,12alpha-dihydroxy-5beta-cholan-24-oic acid [H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(O)=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 C24H40O4 KXGVEGMKQFWNSR-LLQZFEROSA-N 7alpha-deoxycholic acid Desoxycholsaeure (3alpha,5beta,12alpha)-3,12-dihydroxycholan-24-oic acid desoxycholic acid 392.293 392.57200 InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1 (3ALPHA,5ALPHA,12ALPHA)-3,12-DIHYDROXYCHOLAN-24-OIC ACID 3alpha,12alpha-Dihydroxy-5beta-cholanic acid 0 |
|
| Definitions |
A bile acid that is 5beta-cholan-24-oic acid substituted by hydroxy groups at positions 3 and 12 respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28834 |
|
| database_cross_reference |
CAS:83-44-3 KEGG:C04483 DrugBank:DB03619 KNApSAcK:C00030117 LINCS:LSM-5529 PDBeChem:DXC Gmelin:670078 Beilstein:3219882 Drug_Central:4988 LIPID_MAPS_instance:LMST04010040 |
|
| definition |
A bile acid that is 5beta-cholan-24-oic acid substituted by hydroxy groups at positions 3 and 12 respectively. |
|
| has_alternative_id |
CHEBI:23616 CHEBI:1687 CHEBI:42317 |
|
| has_exact_synonym |
Deoxycholic acid 3alpha,12alpha-dihydroxy-5beta-cholan-24-oic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(O)=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 C24H40O4 KXGVEGMKQFWNSR-LLQZFEROSA-N 7alpha-deoxycholic acid Desoxycholsaeure (3alpha,5beta,12alpha)-3,12-dihydroxycholan-24-oic acid desoxycholic acid 392.293 392.57200 InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1 (3ALPHA,5ALPHA,12ALPHA)-3,12-DIHYDROXYCHOLAN-24-OIC ACID 3alpha,12alpha-Dihydroxy-5beta-cholanic acid 0 |
|
| id |
CHEBI:28834 |
|
| imported from | ||
| in_subset | ||
| label |
deoxycholic acid |
|
| notation |
CHEBI:28834 |
|
| prefixIRI |
CHEBI:28834 |
|
| prefLabel |
deoxycholic acid |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.