loading...| Preferred Name |
L-lysine |
|
| Synonyms |
L-Lysine (2S)-2,6-diaminohexanoic acid L-lysine L-2,6-Diaminocaproic acid C6H14N2O2 lysine 6-ammonio-L-norleucine 146.18764 L-Lysin 146.106 (S)-alpha,epsilon-diaminocaproic acid (S)-lysine (S)-2,6-diaminohexanoic acid lysinum Lys NCCCC[C@H](N)C(O)=O InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 Lysine acid lysina K 0 KDXKERNSBIXSRK-YFKPBYRVSA-N |
|
| Definitions |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18019 |
|
| database_cross_reference |
PMID:22575419 HMDB:HMDB00182 CAS:56-87-1 Beilstein:1722531 PMID:23325920 PMID:23722415 PMID:25108762 ECMDB:ECMDB00182 Wikipedia:Lysine Drug_Central:1622 Reaxys:1722531 Gmelin:364182 PMID:23167968 PMID:24831709 PMID:17051348 PMID:16901854 PMID:24064214 PMID:22735334 YMDB:YMDB00330 MetaCyc:LYS PMID:10930630 DrugBank:DB00123 KNApSAcK:C00001378 KEGG:D02304 PMID:17979222 PMID:22019452 PMID:8587651 PMID:22064742 KEGG:C00047 PMID:8070089 |
|
| definition |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| has_alternative_id |
CHEBI:6264 CHEBI:43950 CHEBI:13135 CHEBI:21351 |
|
| has_exact_synonym |
L-Lysine (2S)-2,6-diaminohexanoic acid L-lysine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
L-2,6-Diaminocaproic acid C6H14N2O2 lysine 6-ammonio-L-norleucine 146.18764 L-Lysin 146.106 (S)-alpha,epsilon-diaminocaproic acid (S)-lysine (S)-2,6-diaminohexanoic acid lysinum Lys NCCCC[C@H](N)C(O)=O InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 Lysine acid lysina K 0 KDXKERNSBIXSRK-YFKPBYRVSA-N |
|
| id |
CHEBI:18019 |
|
| imported from | ||
| in_subset | ||
| label |
L-lysine |
|
| notation |
CHEBI:18019 |
|
| prefixIRI |
CHEBI:18019 |
|
| prefLabel |
L-lysine |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.