loading...| Preferred Name |
L-citrulline |
|
| Synonyms |
N(5)-carbamoyl-L-ornithine L-citrulline L-Citrulline (2S)-2-amino-5-(carbamoylamino)pentanoic acid N5-(Aminocarbonyl)ornithine 175.096 alpha-amino-delta-ureidovaleric acid N[C@@H](CCCNC(N)=O)C(O)=O delta-ureidonorvaline (S)-2-Amino-5-ureidopentanoic acid C6H13N3O3 Cit N(delta)-carbamylornithine N(5)-(aminocarbonyl)-L-ornithine 2-Amino-5-ureidovaleric acid 175.18584 RHGKLRLOHDJJDR-BYPYZUCNSA-N InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 L-2-Amino-5-ureidovaleric acid Citrulline 0 N5-carbamoylornithine CITRULLINE |
|
| Definitions |
The L-enantiomer of citrulline. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16349 |
|
| database_cross_reference |
PMID:11862757 KNApSAcK:C00001348 PDBeChem:CIR YMDB:YMDB00060 PMID:22402472 PMID:22388927 Drug_Central:3103 PMID:22402328 PMID:22119809 PMID:21915076 Wikipedia:Citrulline Beilstein:6055157 Gmelin:774677 MetaCyc:L-CITRULLINE HMDB:HMDB00904 PMID:22512552 PMID:22387109 KEGG:D07706 CAS:372-75-8 DrugBank:DB00155 PMID:22345866 ECMDB:ECMDB00904 Beilstein:1725416 PMID:21955999 KEGG:C00327 PMID:22348173 PMID:19173225 PMID:17190852 PMID:21067832 PMID:18022291 Reaxys:1725416 |
|
| definition |
The L-enantiomer of citrulline. |
|
| has_alternative_id |
CHEBI:41489 CHEBI:21257 CHEBI:6203 CHEBI:13092 |
|
| has_exact_synonym |
N(5)-carbamoyl-L-ornithine L-citrulline L-Citrulline (2S)-2-amino-5-(carbamoylamino)pentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N5-(Aminocarbonyl)ornithine 175.096 alpha-amino-delta-ureidovaleric acid N[C@@H](CCCNC(N)=O)C(O)=O delta-ureidonorvaline (S)-2-Amino-5-ureidopentanoic acid C6H13N3O3 Cit N(delta)-carbamylornithine N(5)-(aminocarbonyl)-L-ornithine 2-Amino-5-ureidovaleric acid 175.18584 RHGKLRLOHDJJDR-BYPYZUCNSA-N InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 L-2-Amino-5-ureidovaleric acid Citrulline 0 N5-carbamoylornithine CITRULLINE |
|
| id |
CHEBI:16349 |
|
| imported from | ||
| in_subset | ||
| label |
L-citrulline |
|
| notation |
CHEBI:16349 |
|
| prefixIRI |
CHEBI:16349 |
|
| prefLabel |
L-citrulline |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.