loading...| Preferred Name |
quinapril |
|
| Synonyms |
(3S)-2-{(2S)-2-[(1S)-1-ethoxycarbonyl-3-phenylpropylamino]propanoyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (3S)-2-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Quinapril (3S)-2-{N-[(2S)-1-ethoxycarbonyl-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid quinaprilum quinapril |
|
| Definitions |
A member of the class of isoquinolines that is (3S)-2-L-alanyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid in which the alpha-amino group of the alanyl residue has been substituted by a 1-ethoxycarbonyl-4-phenylbutan-2-yl group (the all-S isomer). A prodrug for quinaprilat (by hydrolysis of the ethyl ester to the corresponding carboxylic acid), it is used as an angiotensin-converting enzyme inhibitor (ACE inhibitor) used (generally as the hydrochloride salt) for the treatment of hypertension and congestive heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8713 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-3620 Drug_Central:2340 Patent:US4344949 PMID:27165572 KEGG:C07398 Wikipedia:Quinapril PMID:27169890 CAS:85441-61-8 KEGG:D03752 DrugBank:DB00881 PMID:29980144 PMID:17404826 |
|
| definition |
A member of the class of isoquinolines that is (3S)-2-L-alanyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid in which the alpha-amino group of the alanyl residue has been substituted by a 1-ethoxycarbonyl-4-phenylbutan-2-yl group (the all-S isomer). A prodrug for quinaprilat (by hydrolysis of the ethyl ester to the corresponding carboxylic acid), it is used as an angiotensin-converting enzyme inhibitor (ACE inhibitor) used (generally as the hydrochloride salt) for the treatment of hypertension and congestive heart failure. |
|
| formula |
C25H30N2O5 |
|
| has role | ||
| has_exact_synonym |
(3S)-2-{(2S)-2-[(1S)-1-ethoxycarbonyl-3-phenylpropylamino]propanoyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (3S)-2-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Quinapril |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(3S)-2-{N-[(2S)-1-ethoxycarbonyl-4-phenylbutan-2-yl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid quinaprilum quinapril |
|
| has_RxCUI |
35208 |
|
| id |
CHEBI:8713 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H30N2O5/c1-3-32-25(31)21(14-13-18-9-5-4-6-10-18)26-17(2)23(28)27-16-20-12-8-7-11-19(20)15-22(27)24(29)30/h4-12,17,21-22,26H,3,13-16H2,1-2H3,(H,29,30)/t17-,21-,22-/m0/s1 |
|
| inchikey |
JSDRRTOADPPCHY-HSQYWUDLSA-N |
|
| is_bearer_of | ||
| label |
quinapril |
|
| mass |
438.517 |
|
| monoisotopicmass |
438.21547 |
|
| notation |
CHEBI:8713 |
|
| prefLabel |
quinapril |
|
| smiles |
C1C2=C(C[C@H](N1C([C@@H](N[C@H](C(OCC)=O)CCC=3C=CC=CC3)C)=O)C(O)=O)C=CC=C2 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_140326 http://purl.obolibrary.org/obo/CHEBI_24922 |