Preferred Name |
fenofibrate |
|
Synonyms |
Fenofibrate propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate Finofibrate 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester Isopropyl 2-(4-(4-chlorobenzoyl)phenoxy)-2-methylpropionate Isopropyl (4'-(p-chlorobenzoyl)-2-phenoxy-2-methyl)propionate Antara FNF Lipantil Lipofen Procetofen Tricor Triglide |
|
Definitions |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5001 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-3107 CAS:49562-28-9 DrugBank:DB01039 KEGG:C07586 Patent:US4058552 Patent:DE2250327 Reaxys:2062462 Chemspider:3222 KEGG:D00565 PMID:18212815 PMID:17449930 HMDB:HMDB0015173 PMID:33704429 Drug_Central:1152 PMID:34244236 PMID:34515330 Wikipedia:Fenofibrate PMID:32675219 PMID:23603800 |
|
definition |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
formula |
C20H21ClO4 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35679 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
has_exact_synonym |
Fenofibrate propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Finofibrate 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester Isopropyl 2-(4-(4-chlorobenzoyl)phenoxy)-2-methylpropionate Isopropyl (4'-(p-chlorobenzoyl)-2-phenoxy-2-methyl)propionate Antara FNF Lipantil Lipofen Procetofen Tricor Triglide |
|
has_RxCUI |
8703 |
|
id |
CHEBI:5001 |
|
in_subset | ||
inchi |
InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
|
inchikey |
YMTINGFKWWXKFG-UHFFFAOYSA-N |
|
label |
fenofibrate Fenofibrate |
|
mass |
360.83100 |
|
monoisotopicmass |
360.11284 |
|
notation |
CHEBI:5001 |
|
prefLabel |
fenofibrate |
|
smiles |
CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_83403 |