Preferred Name |
Trimethadione |
|
Synonyms |
3,5,5-trimethyl-1,3-oxazolidine-2,4-dione trimethadione trimetadiona trimethadionum 3,5,5-trimethyl-2,4-oxazolidinedione trimetadione Tridione Dulcet Absentol Absetil Convenixa Edion Epidione Epixal Petidion Petilep Petimalin Ptimal Tridione |
|
Definitions |
An oxazolidinone that is 1,3-oxazolidine-2,4-dione substituted by methyl groups at positions 3, 5 and 5. It is an antiepileptic agent. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9727 |
|
charge |
0 |
|
database_cross_reference |
PMID:11722678 PMID:8865369 PMID:13649111 Drug_Central:2751 PMID:8791774 KEGG:D00392 PMID:18862627 CAS:127-48-0 PMID:7653500 HMDB:HMDB0014491 Wikipedia:Trimethadione PMID:2210093 PMID:30605901 PMID:21638752 PMID:23017458 PMID:16171802 Reaxys:121627 PMID:18876072 PMID:9375358 PMID:13590839 PMID:18248662 PMID:11057156 PMID:15653505 LINCS:LSM-5345 PMID:10634315 PMID:15282739 PMID:9827046 PMID:23321016 DrugBank:DB00347 |
|
definition |
An oxazolidinone that is 1,3-oxazolidine-2,4-dione substituted by methyl groups at positions 3, 5 and 5. It is an antiepileptic agent. |
|
formula |
C6H9NO3 |
|
has role | ||
has_alternative_id |
CHEBI:94526 |
|
has_exact_synonym |
3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
trimethadione trimetadiona trimethadionum 3,5,5-trimethyl-2,4-oxazolidinedione trimetadione Tridione Dulcet Absentol Absetil Convenixa Edion Epidione Epixal Petidion Petilep Petimalin Ptimal Tridione |
|
has_RxCUI |
10827 |
|
id |
CHEBI:9727 |
|
in_subset | ||
inchi |
InChI=1S/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
|
inchikey |
IRYJRGCIQBGHIV-UHFFFAOYSA-N |
|
label |
trimethadione Trimethadione |
|
mass |
143.142 |
|
monoisotopicmass |
143.05824 |
|
notation |
CHEBI:9727 |
|
prefLabel |
Trimethadione |
|
smiles |
CN1C(=O)OC(C)(C)C1=O |
|
subClassOf |