Preferred Name |
mesalamine |
|
Synonyms |
5-amino-2-hydroxybenzoic acid 3-carboxy-4-hydroxyaniline 5-Aminosalicylic acid mesalazinum m-Aminosalicylic acid p-Aminosalicylsaeure 5-ASA Asacol Asacolitin Canasa Claversal Fisalamine Iialda Lixacol Mesalazine Mesasal Pentasa Rowasa Salofalk mesalazina mesalazine |
|
Definitions |
A monohydroxybenzoic acid that is salicylic acid substituted by an amino group at the 5-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6775 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00244 Wikipedia:Mesalamine LINCS:LSM-5427 Beilstein:2090421 HMDB:HMDB0014389 PMID:22304735 PMID:23146664 MetaCyc:CPD-12711 CAS:89-57-6 PMID:23137838 Drug_Central:1710 PMID:23302220 KEGG:D00377 PMID:10648473 PMID:28166217 Reaxys:2090421 PMID:22648999 |
|
definition |
A monohydroxybenzoic acid that is salicylic acid substituted by an amino group at the 5-position. |
|
formula |
C7H7NO3 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
5-amino-2-hydroxybenzoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-carboxy-4-hydroxyaniline 5-Aminosalicylic acid mesalazinum m-Aminosalicylic acid p-Aminosalicylsaeure 5-ASA Asacol Asacolitin Canasa Claversal Fisalamine Iialda Lixacol Mesalazine Mesasal Pentasa Rowasa Salofalk mesalazina mesalazine |
|
has_RxCUI |
52582 |
|
id |
CHEBI:6775 |
|
in_subset | ||
inchi |
InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
|
inchikey |
KBOPZPXVLCULAV-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
mesalamine |
|
mass |
153.13540 |
|
monoisotopicmass |
153.04259 |
|
notation |
CHEBI:6775 |
|
prefLabel |
mesalamine |
|
smiles |
Nc1ccc(O)c(c1)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33860 http://purl.obolibrary.org/obo/CHEBI_33709 |