Preferred Name |
Memantine |
|
Synonyms |
3,5-dimethyladamantan-1-amine 3,5-Dimethyltricyclo(3.3.1.1(3,7))decan-1-amine 1-Amino-3,5-dimethyladamantane 3,5-Dimethyl-1-adamantanamine 3,5-Dimethyl-1-aminoadamantane 1,3-Dimethyl-5-adamantanamine memantina memantine memantinum |
|
Definitions |
A primary aliphatic amine that is the 3,5-dimethyl derivative of 1-aminoadamantane. A low to moderate affinity uncompetitive (open-channel); NMDA receptor antagonist which binds preferentially to the NMDA receptor-operated cation channels. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64312 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB01043 Drug_Central:1679 PMID:22134197 PMID:21955815 KEGG:C13736 PMID:22300835 PMID:22030128 PMID:21953515 PMID:22329473 PMID:22414570 PMID:22245025 PMID:22392787 Wikipedia:Memantine KEGG:D08174 PMID:22311362 Reaxys:2075983 PMID:22290557 PMID:20104942 Patent:US2011282100 PMID:22425751 LINCS:LSM-5154 CAS:19982-08-2 PMID:22327556 PMID:22297273 PMID:22248638 |
|
definition |
A primary aliphatic amine that is the 3,5-dimethyl derivative of 1-aminoadamantane. A low to moderate affinity uncompetitive (open-channel); NMDA receptor antagonist which binds preferentially to the NMDA receptor-operated cation channels. |
|
formula |
C12H21N |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_63726 http://purl.obolibrary.org/obo/CHEBI_35469 |
|
has_alternative_id |
CHEBI:34832 |
|
has_exact_synonym |
3,5-dimethyladamantan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3,5-Dimethyltricyclo(3.3.1.1(3,7))decan-1-amine 1-Amino-3,5-dimethyladamantane 3,5-Dimethyl-1-adamantanamine 3,5-Dimethyl-1-aminoadamantane 1,3-Dimethyl-5-adamantanamine memantina memantine memantinum |
|
has_RxCUI |
6719 |
|
id |
CHEBI:64312 |
|
in_subset | ||
inchi |
InChI=1S/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3 |
|
inchikey |
BUGYDGFZZOZRHP-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
Memantine memantine |
|
mass |
179.30180 |
|
monoisotopicmass |
179.16740 |
|
notation |
CHEBI:64312 |
|
prefLabel |
Memantine |
|
smiles |
CC12CC3CC(C)(C1)CC(N)(C3)C2 |
|
subClassOf |