Preferred Name |
naringenin |
|
Synonyms |
5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
|
Definitions |
A trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50202 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:280888 LINCS:LSM-1927 MetaCyc:Naringenin |
|
definition |
A trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. |
|
formula |
C15H12O5 |
|
has_exact_synonym |
5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:50202 |
|
in_subset | ||
inchi |
InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2 |
|
inchikey |
FTVWIRXFELQLPI-UHFFFAOYSA-N |
|
label |
naringenin |
|
mass |
272.25278 |
|
monoisotopicmass |
272.06847 |
|
notation |
CHEBI:50202 |
|
prefLabel |
naringenin |
|
smiles |
Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1 |
|
subClassOf |
Create mapping