Preferred Name |
loracarbef |
|
Synonyms |
(6R,7S)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 7beta-[(2R)-2-amino-2-phenylacetyl]nitrilo-3-chloro-3,4-didehydrocepham-4-carboxylic acid loracarbefum LORACABEF loracarbef |
|
Definitions |
A synthetic "carba" analogue of cefaclor, with carbon replacing sulfur at position 1. Used to treat a wide range of infections caused by both gram-positive and gram-negative bacteria. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_47544 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00447 Beilstein:3631282 PMID:1621742 PMID:9131470 PMID:1621740 KEGG:D08143 Reaxys:3631282 LINCS:LSM-5429 CAS:76470-66-1 Patent:US4708956 PMID:8453172 PMID:1553350 PMID:29017833 HMDB:HMDB0014590 PDBeChem:LOR Patent:EP14476 Drug_Central:1603 |
|
definition |
A synthetic "carba" analogue of cefaclor, with carbon replacing sulfur at position 1. Used to treat a wide range of infections caused by both gram-positive and gram-negative bacteria. |
|
formula |
C16H16ClN3O4 |
|
has role | ||
has_exact_synonym |
(6R,7S)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 7beta-[(2R)-2-amino-2-phenylacetyl]nitrilo-3-chloro-3,4-didehydrocepham-4-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
loracarbefum LORACABEF loracarbef |
|
has_RxCUI |
28981 |
|
id |
CHEBI:47544 |
|
in_subset | ||
inchi |
InChI=1S/C16H16ClN3O4/c17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8/h1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24)/t10-,11-,12+/m1/s1 |
|
inchikey |
JAPHQRWPEGVNBT-UTUOFQBUSA-N |
|
is conjugate acid of | ||
is tautomer of | ||
label |
loracarbef |
|
mass |
349.76900 |
|
monoisotopicmass |
349.08293 |
|
notation |
CHEBI:47544 |
|
prefLabel |
loracarbef |
|
smiles |
N[C@@H](C(=O)N[C@H]1[C@H]2CCC(Cl)=C(N2C1=O)C(O)=O)c1ccccc1 |
|
subClassOf |